C14H16N6S — CID 8961761
4-[2,5-dimethyl-1-(1H-1,2,4-triazol-5-yl)pyrrol-3-yl]-N-prop-2-enyl-1,3-thiazol-2-amine (PubChem CID 8961761) has the molecular formula C14H16N6S and a molecular weight of 300.39 g/mol. Its IUPAC name is 4-[2,5-dimethyl-1-(1H-1,2,4-triazol-5-yl)pyrrol-3-yl]-N-prop-2-enyl-1,3-thiazol-2-amine.
| Compound Name | 4-[2,5-dimethyl-1-(1H-1,2,4-triazol-5-yl)pyrrol-3-yl]-N-prop-2-enyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 8961761 |
| Molecular Formula | C14H16N6S |
| Molecular Weight | 300.39 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | 4-[2,5-dimethyl-1-(1H-1,2,4-triazol-5-yl)pyrrol-3-yl]-N-prop-2-enyl-1,3-thiazol-2-amine |
| SMILES | C=CCNc1nc(-c2cc(C)n(-c3ncn[nH]3)c2C)cs1 |
| InChI | InChI=1S/C14H16N6S/c1-4-5-15-14-18-12(7-21-14)11-6-9(2)20(10(11)3)13-16-8-17-19-13/h4,6-8H,1,5H2,2-3H3,(H,15,18)(H,16,17,19) |
| InChIKey | AOEXDRMFWFFFOH-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.39 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|