C16H20N4S2 — CID 8962655
N-butyl-4-[2,5-dimethyl-1-(1,3-thiazol-2-yl)pyrrol-3-yl]-1,3-thiazol-2-amine (PubChem CID 8962655) has the molecular formula C16H20N4S2 and a molecular weight of 332.50 g/mol. Its IUPAC name is N-butyl-4-[2,5-dimethyl-1-(1,3-thiazol-2-yl)pyrrol-3-yl]-1,3-thiazol-2-amine.
| Compound Name | N-butyl-4-[2,5-dimethyl-1-(1,3-thiazol-2-yl)pyrrol-3-yl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 8962655 |
| Molecular Formula | C16H20N4S2 |
| Molecular Weight | 332.50 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | N-butyl-4-[2,5-dimethyl-1-(1,3-thiazol-2-yl)pyrrol-3-yl]-1,3-thiazol-2-amine |
| SMILES | CCCCNc1nc(-c2cc(C)n(-c3nccs3)c2C)cs1 |
| InChI | InChI=1S/C16H20N4S2/c1-4-5-6-17-15-19-14(10-22-15)13-9-11(2)20(12(13)3)16-18-7-8-21-16/h7-10H,4-6H2,1-3H3,(H,17,19) |
| InChIKey | QVKCUZIOSAUZGJ-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.50 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|