C13H16N2S — CID 8963113
4-(2,5-dimethylphenyl)-N,5-dimethyl-1,3-thiazol-2-amine (PubChem CID 8963113) has the molecular formula C13H16N2S and a molecular weight of 232.35 g/mol. Its IUPAC name is 4-(2,5-dimethylphenyl)-N,5-dimethyl-1,3-thiazol-2-amine.
| Compound Name | 4-(2,5-dimethylphenyl)-N,5-dimethyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 8963113 |
| Molecular Formula | C13H16N2S |
| Molecular Weight | 232.35 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | 4-(2,5-dimethylphenyl)-N,5-dimethyl-1,3-thiazol-2-amine |
| SMILES | CNc1nc(-c2cc(C)ccc2C)c(C)s1 |
| InChI | InChI=1S/C13H16N2S/c1-8-5-6-9(2)11(7-8)12-10(3)16-13(14-4)15-12/h5-7H,1-4H3,(H,14,15) |
| InChIKey | OCGPBKHPSBFEAP-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.35 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |