About methyl 5-[2-(tert-butylamino)-5-methyl-1,3-thiazol-4-yl]-2,4-dimethyl-1H-pyrrole-3-carboxylate
methyl 5-[2-(tert-butylamino)-5-methyl-1,3-thiazol-4-yl]-2,4-dimethyl-1H-pyrrole-3-carboxylate (PubChem CID 8963232) has the molecular formula C16H23N3O2S
and a molecular weight of 321.45 g/mol. Its IUPAC name is methyl 5-[2-(tert-butylamino)-5-methyl-1,3-thiazol-4-yl]-2,4-dimethyl-1H-pyrrole-3-carboxylate.
Molecular Properties
| Compound Name | methyl 5-[2-(tert-butylamino)-5-methyl-1,3-thiazol-4-yl]-2,4-dimethyl-1H-pyrrole-3-carboxylate |
| PubChem CID | 8963232 |
| Molecular Formula | C16H23N3O2S |
| Molecular Weight | 321.45 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | methyl 5-[2-(tert-butylamino)-5-methyl-1,3-thiazol-4-yl]-2,4-dimethyl-1H-pyrrole-3-carboxylate |
| SMILES | COC(=O)c1c(C)[nH]c(-c2nc(NC(C)(C)C)sc2C)c1C |
| InChI | InChI=1S/C16H23N3O2S/c1-8-11(14(20)21-7)9(2)17-12(8)13-10(3)22-15(18-13)19-16(4,5)6/h17H,1-7H3,(H,18,19) |
| InChIKey | WAEWIJBNCDAXLI-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.45 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 5-[2-(tert-butylamino)-5-methyl-1,3-thiazol-4-yl]-2,4-dimethyl-1H-pyrrole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-[2-(tert-butylamino)-5-methyl-1,3-thiazol-4-yl]-2,4-dimethyl-1H-pyrrole-3-carboxylate?
The IUPAC name of methyl 5-[2-(tert-butylamino)-5-methyl-1,3-thiazol-4-yl]-2,4-dimethyl-1H-pyrrole-3-carboxylate (CID 8963232) is methyl 5-[2-(tert-butylamino)-5-methyl-1,3-thiazol-4-yl]-2,4-dimethyl-1H-pyrrole-3-carboxylate.
What is the SMILES notation for methyl 5-[2-(tert-butylamino)-5-methyl-1,3-thiazol-4-yl]-2,4-dimethyl-1H-pyrrole-3-carboxylate?
The canonical SMILES for methyl 5-[2-(tert-butylamino)-5-methyl-1,3-thiazol-4-yl]-2,4-dimethyl-1H-pyrrole-3-carboxylate is COC(=O)c1c(C)[nH]c(-c2nc(NC(C)(C)C)sc2C)c1C.
What is the InChIKey of methyl 5-[2-(tert-butylamino)-5-methyl-1,3-thiazol-4-yl]-2,4-dimethyl-1H-pyrrole-3-carboxylate?
The InChIKey is WAEWIJBNCDAXLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23N3O2S/c1-8-11(14(20)21-7)9(2)17-12(8)13-10(3)22-15(18-13)19-16(4,5)6/h17H,1-7H3,(H,18,19).
What are the key properties of methyl 5-[2-(tert-butylamino)-5-methyl-1,3-thiazol-4-yl]-2,4-dimethyl-1H-pyrrole-3-carboxylate?
methyl 5-[2-(tert-butylamino)-5-methyl-1,3-thiazol-4-yl]-2,4-dimethyl-1H-pyrrole-3-carboxylate has a molecular weight of 321.45 g/mol, XLogP of 4.06, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-[2-(tert-butylamino)-5-methyl-1,3-thiazol-4-yl]-2,4-dimethyl-1H-pyrrole-3-carboxylate is sourced from PubChem (CID 8963232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).