About 4-(methanesulfonamido)-N,N-dipropylbenzenesulfonamide
4-(methanesulfonamido)-N,N-dipropylbenzenesulfonamide (PubChem CID 896369) has the molecular formula C13H22N2O4S2
and a molecular weight of 334.46 g/mol. Its IUPAC name is 4-(methanesulfonamido)-N,N-dipropylbenzenesulfonamide.
Molecular Properties
| Compound Name | 4-(methanesulfonamido)-N,N-dipropylbenzenesulfonamide |
| PubChem CID | 896369 |
| Molecular Formula | C13H22N2O4S2 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | 4-(methanesulfonamido)-N,N-dipropylbenzenesulfonamide |
| SMILES | CCCN(CCC)S(=O)(=O)c1ccc(NS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C13H22N2O4S2/c1-4-10-15(11-5-2)21(18,19)13-8-6-12(7-9-13)14-20(3,16)17/h6-9,14H,4-5,10-11H2,1-3H3 |
| InChIKey | AANQOFIRUXFHTC-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(methanesulfonamido)-N,N-dipropylbenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(methanesulfonamido)-N,N-dipropylbenzenesulfonamide?
The IUPAC name of 4-(methanesulfonamido)-N,N-dipropylbenzenesulfonamide (CID 896369) is 4-(methanesulfonamido)-N,N-dipropylbenzenesulfonamide.
What is the SMILES notation for 4-(methanesulfonamido)-N,N-dipropylbenzenesulfonamide?
The canonical SMILES for 4-(methanesulfonamido)-N,N-dipropylbenzenesulfonamide is CCCN(CCC)S(=O)(=O)c1ccc(NS(C)(=O)=O)cc1.
What is the InChIKey of 4-(methanesulfonamido)-N,N-dipropylbenzenesulfonamide?
The InChIKey is AANQOFIRUXFHTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N2O4S2/c1-4-10-15(11-5-2)21(18,19)13-8-6-12(7-9-13)14-20(3,16)17/h6-9,14H,4-5,10-11H2,1-3H3.
What are the key properties of 4-(methanesulfonamido)-N,N-dipropylbenzenesulfonamide?
4-(methanesulfonamido)-N,N-dipropylbenzenesulfonamide has a molecular weight of 334.46 g/mol, XLogP of 1.87, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(methanesulfonamido)-N,N-dipropylbenzenesulfonamide is sourced from PubChem (CID 896369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).