About 6-amino-3-methyl-5-[2-[methyl(thiophen-2-ylmethyl)amino]acetyl]-1-propylpyrimidine-2,4-dione
6-amino-3-methyl-5-[2-[methyl(thiophen-2-ylmethyl)amino]acetyl]-1-propylpyrimidine-2,4-dione (PubChem CID 8964907) has the molecular formula C16H22N4O3S
and a molecular weight of 350.44 g/mol. Its IUPAC name is 6-amino-3-methyl-5-[2-[methyl(thiophen-2-ylmethyl)amino]acetyl]-1-propylpyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 6-amino-3-methyl-5-[2-[methyl(thiophen-2-ylmethyl)amino]acetyl]-1-propylpyrimidine-2,4-dione |
| PubChem CID | 8964907 |
| Molecular Formula | C16H22N4O3S |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | 6-amino-3-methyl-5-[2-[methyl(thiophen-2-ylmethyl)amino]acetyl]-1-propylpyrimidine-2,4-dione |
| SMILES | CCCn1c(N)c(C(=O)CN(C)Cc2cccs2)c(=O)n(C)c1=O |
| InChI | InChI=1S/C16H22N4O3S/c1-4-7-20-14(17)13(15(22)19(3)16(20)23)12(21)10-18(2)9-11-6-5-8-24-11/h5-6,8H,4,7,9-10,17H2,1-3H3 |
| InChIKey | HJLXYMXLPFWIQH-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 90.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 6-amino-3-methyl-5-[2-[methyl(thiophen-2-ylmethyl)amino]acetyl]-1-propylpyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-3-methyl-5-[2-[methyl(thiophen-2-ylmethyl)amino]acetyl]-1-propylpyrimidine-2,4-dione?
The IUPAC name of 6-amino-3-methyl-5-[2-[methyl(thiophen-2-ylmethyl)amino]acetyl]-1-propylpyrimidine-2,4-dione (CID 8964907) is 6-amino-3-methyl-5-[2-[methyl(thiophen-2-ylmethyl)amino]acetyl]-1-propylpyrimidine-2,4-dione.
What is the SMILES notation for 6-amino-3-methyl-5-[2-[methyl(thiophen-2-ylmethyl)amino]acetyl]-1-propylpyrimidine-2,4-dione?
The canonical SMILES for 6-amino-3-methyl-5-[2-[methyl(thiophen-2-ylmethyl)amino]acetyl]-1-propylpyrimidine-2,4-dione is CCCn1c(N)c(C(=O)CN(C)Cc2cccs2)c(=O)n(C)c1=O.
What is the InChIKey of 6-amino-3-methyl-5-[2-[methyl(thiophen-2-ylmethyl)amino]acetyl]-1-propylpyrimidine-2,4-dione?
The InChIKey is HJLXYMXLPFWIQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22N4O3S/c1-4-7-20-14(17)13(15(22)19(3)16(20)23)12(21)10-18(2)9-11-6-5-8-24-11/h5-6,8H,4,7,9-10,17H2,1-3H3.
What are the key properties of 6-amino-3-methyl-5-[2-[methyl(thiophen-2-ylmethyl)amino]acetyl]-1-propylpyrimidine-2,4-dione?
6-amino-3-methyl-5-[2-[methyl(thiophen-2-ylmethyl)amino]acetyl]-1-propylpyrimidine-2,4-dione has a molecular weight of 350.44 g/mol, XLogP of 0.92, 7 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-3-methyl-5-[2-[methyl(thiophen-2-ylmethyl)amino]acetyl]-1-propylpyrimidine-2,4-dione is sourced from PubChem (CID 8964907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).