C15H14ClF3N2OS — CID 8965256
N-[2-chloro-5-(trifluoromethyl)phenyl]-2-[methyl(thiophen-2-ylmethyl)amino]acetamide (PubChem CID 8965256) has the molecular formula C15H14ClF3N2OS and a molecular weight of 362.80 g/mol. Its IUPAC name is N-[2-chloro-5-(trifluoromethyl)phenyl]-2-[methyl(thiophen-2-ylmethyl)amino]acetamide.
| Compound Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-2-[methyl(thiophen-2-ylmethyl)amino]acetamide |
|---|---|
| PubChem CID | 8965256 |
| Molecular Formula | C15H14ClF3N2OS |
| Molecular Weight | 362.80 g/mol |
| Exact Mass | 362.05 |
| IUPAC Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-2-[methyl(thiophen-2-ylmethyl)amino]acetamide |
| SMILES | CN(CC(=O)Nc1cc(C(F)(F)F)ccc1Cl)Cc1cccs1 |
| InChI | InChI=1S/C15H14ClF3N2OS/c1-21(8-11-3-2-6-23-11)9-14(22)20-13-7-10(15(17,18)19)4-5-12(13)16/h2-7H,8-9H2,1H3,(H,20,22) |
| InChIKey | YYABDROWSXNQRO-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.80 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |