C21H26N2O2 — CID 8965725
2-[[(1S,2S)-2-methylcyclohexyl]amino]-N-(2-phenoxyphenyl)acetamide (PubChem CID 8965725) has the molecular formula C21H26N2O2 and a molecular weight of 338.45 g/mol. Its IUPAC name is 2-[[(1S,2S)-2-methylcyclohexyl]amino]-N-(2-phenoxyphenyl)acetamide.
| Compound Name | 2-[[(1S,2S)-2-methylcyclohexyl]amino]-N-(2-phenoxyphenyl)acetamide |
|---|---|
| PubChem CID | 8965725 |
| Molecular Formula | C21H26N2O2 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | 2-[[(1S,2S)-2-methylcyclohexyl]amino]-N-(2-phenoxyphenyl)acetamide |
| SMILES | C[C@H]1CCCC[C@@H]1NCC(=O)Nc1ccccc1Oc1ccccc1 |
| InChI | InChI=1S/C21H26N2O2/c1-16-9-5-6-12-18(16)22-15-21(24)23-19-13-7-8-14-20(19)25-17-10-3-2-4-11-17/h2-4,7-8,10-11,13-14,16,18,22H,5-6,9,12,15H2,1H3,(H,23,24)/t16-,18-/m0/s1 |
| InChIKey | YGBIHAAZBGMFRG-WMZOPIPTSA-N |
| XLogP | 4.59 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |