C21H22N2O4 — CID 8966120
4-[[[(E)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enoyl]-methylamino]methyl]-N-methylbenzamide (PubChem CID 8966120) has the molecular formula C21H22N2O4 and a molecular weight of 366.42 g/mol. Its IUPAC name is 4-[[[(E)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enoyl]-methylamino]methyl]-N-methylbenzamide.
| Compound Name | 4-[[[(E)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enoyl]-methylamino]methyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 8966120 |
| Molecular Formula | C21H22N2O4 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | 4-[[[(E)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enoyl]-methylamino]methyl]-N-methylbenzamide |
| SMILES | CNC(=O)c1ccc(CN(C)C(=O)/C=C/c2ccc3c(c2)OCCO3)cc1 |
| InChI | InChI=1S/C21H22N2O4/c1-22-21(25)17-7-3-16(4-8-17)14-23(2)20(24)10-6-15-5-9-18-19(13-15)27-12-11-26-18/h3-10,13H,11-12,14H2,1-2H3,(H,22,25)/b10-6+ |
| InChIKey | FNGYITAEMGGEPK-UXBLZVDNSA-N |
| XLogP | 2.49 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|