C15H19N3O3 — CID 8966947
(2R)-N-methyl-N-[[4-(methylcarbamoyl)phenyl]methyl]-5-oxopyrrolidine-2-carboxamide (PubChem CID 8966947) has the molecular formula C15H19N3O3 and a molecular weight of 289.34 g/mol. Its IUPAC name is (2R)-N-methyl-N-[[4-(methylcarbamoyl)phenyl]methyl]-5-oxopyrrolidine-2-carboxamide.
| Compound Name | (2R)-N-methyl-N-[[4-(methylcarbamoyl)phenyl]methyl]-5-oxopyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 8966947 |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | (2R)-N-methyl-N-[[4-(methylcarbamoyl)phenyl]methyl]-5-oxopyrrolidine-2-carboxamide |
| SMILES | CNC(=O)c1ccc(CN(C)C(=O)[C@H]2CCC(=O)N2)cc1 |
| InChI | InChI=1S/C15H19N3O3/c1-16-14(20)11-5-3-10(4-6-11)9-18(2)15(21)12-7-8-13(19)17-12/h3-6,12H,7-9H2,1-2H3,(H,16,20)(H,17,19)/t12-/m1/s1 |
| InChIKey | HQRXBWCEBAIUQC-GFCCVEGCSA-N |
| XLogP | 0.28 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |