About 1-cyclohexyl-3-(4,6-dimethyl-2-pyridinyl)urea
1-cyclohexyl-3-(4,6-dimethyl-2-pyridinyl)urea (PubChem CID 896735) has the molecular formula C14H21N3O
and a molecular weight of 247.34 g/mol. Its IUPAC name is 1-cyclohexyl-3-(4,6-dimethyl-2-pyridinyl)urea.
Molecular Properties
| Compound Name | 1-cyclohexyl-3-(4,6-dimethyl-2-pyridinyl)urea |
| PubChem CID | 896735 |
| Molecular Formula | C14H21N3O |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.17 |
| IUPAC Name | 1-cyclohexyl-3-(4,6-dimethyl-2-pyridinyl)urea |
| SMILES | Cc1cc(C)nc(NC(=O)NC2CCCCC2)c1 |
| InChI | InChI=1S/C14H21N3O/c1-10-8-11(2)15-13(9-10)17-14(18)16-12-6-4-3-5-7-12/h8-9,12H,3-7H2,1-2H3,(H2,15,16,17,18) |
| InChIKey | XOQLXGWEPFUJRD-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-cyclohexyl-3-(4,6-dimethyl-2-pyridinyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexyl-3-(4,6-dimethyl-2-pyridinyl)urea?
The IUPAC name of 1-cyclohexyl-3-(4,6-dimethyl-2-pyridinyl)urea (CID 896735) is 1-cyclohexyl-3-(4,6-dimethyl-2-pyridinyl)urea.
What is the SMILES notation for 1-cyclohexyl-3-(4,6-dimethyl-2-pyridinyl)urea?
The canonical SMILES for 1-cyclohexyl-3-(4,6-dimethyl-2-pyridinyl)urea is Cc1cc(C)nc(NC(=O)NC2CCCCC2)c1.
What is the InChIKey of 1-cyclohexyl-3-(4,6-dimethyl-2-pyridinyl)urea?
The InChIKey is XOQLXGWEPFUJRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21N3O/c1-10-8-11(2)15-13(9-10)17-14(18)16-12-6-4-3-5-7-12/h8-9,12H,3-7H2,1-2H3,(H2,15,16,17,18).
What are the key properties of 1-cyclohexyl-3-(4,6-dimethyl-2-pyridinyl)urea?
1-cyclohexyl-3-(4,6-dimethyl-2-pyridinyl)urea has a molecular weight of 247.34 g/mol, XLogP of 3.15, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexyl-3-(4,6-dimethyl-2-pyridinyl)urea is sourced from PubChem (CID 896735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).