About 3-fluoro-N,N-bis(2-methylpropyl)benzamide
3-fluoro-N,N-bis(2-methylpropyl)benzamide (PubChem CID 896872) has the molecular formula C15H22FNO
and a molecular weight of 251.34 g/mol. Its IUPAC name is 3-fluoro-N,N-bis(2-methylpropyl)benzamide.
Molecular Properties
| Compound Name | 3-fluoro-N,N-bis(2-methylpropyl)benzamide |
| PubChem CID | 896872 |
| Molecular Formula | C15H22FNO |
| Molecular Weight | 251.34 g/mol |
| Exact Mass | 251.17 |
| IUPAC Name | 3-fluoro-N,N-bis(2-methylpropyl)benzamide |
| SMILES | CC(C)CN(CC(C)C)C(=O)c1cccc(F)c1 |
| InChI | InChI=1S/C15H22FNO/c1-11(2)9-17(10-12(3)4)15(18)13-6-5-7-14(16)8-13/h5-8,11-12H,9-10H2,1-4H3 |
| InChIKey | MSWJFWARDTTYKA-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.34 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-fluoro-N,N-bis(2-methylpropyl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-N,N-bis(2-methylpropyl)benzamide?
The IUPAC name of 3-fluoro-N,N-bis(2-methylpropyl)benzamide (CID 896872) is 3-fluoro-N,N-bis(2-methylpropyl)benzamide.
What is the SMILES notation for 3-fluoro-N,N-bis(2-methylpropyl)benzamide?
The canonical SMILES for 3-fluoro-N,N-bis(2-methylpropyl)benzamide is CC(C)CN(CC(C)C)C(=O)c1cccc(F)c1.
What is the InChIKey of 3-fluoro-N,N-bis(2-methylpropyl)benzamide?
The InChIKey is MSWJFWARDTTYKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22FNO/c1-11(2)9-17(10-12(3)4)15(18)13-6-5-7-14(16)8-13/h5-8,11-12H,9-10H2,1-4H3.
What are the key properties of 3-fluoro-N,N-bis(2-methylpropyl)benzamide?
3-fluoro-N,N-bis(2-methylpropyl)benzamide has a molecular weight of 251.34 g/mol, XLogP of 3.58, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-N,N-bis(2-methylpropyl)benzamide is sourced from PubChem (CID 896872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).