About 1-[(2S)-1-(2,2,2-trifluoroethyl)pyrrolidin-2-yl]ethanone
1-[(2S)-1-(2,2,2-trifluoroethyl)pyrrolidin-2-yl]ethanone (PubChem CID 89694527) has the molecular formula C8H12F3NO
and a molecular weight of 195.18 g/mol. Its IUPAC name is 1-[(2S)-1-(2,2,2-trifluoroethyl)pyrrolidin-2-yl]ethanone.
Molecular Properties
| Compound Name | 1-[(2S)-1-(2,2,2-trifluoroethyl)pyrrolidin-2-yl]ethanone |
| PubChem CID | 89694527 |
| Molecular Formula | C8H12F3NO |
| Molecular Weight | 195.18 g/mol |
| Exact Mass | 195.09 |
| IUPAC Name | 1-[(2S)-1-(2,2,2-trifluoroethyl)pyrrolidin-2-yl]ethanone |
| SMILES | CC(=O)[C@@H]1CCCN1CC(F)(F)F |
| InChI | InChI=1S/C8H12F3NO/c1-6(13)7-3-2-4-12(7)5-8(9,10)11/h7H,2-5H2,1H3/t7-/m0/s1 |
| InChIKey | XFDPMINGSHKVNA-ZETCQYMHSA-N |
| XLogP | 1.70 |
| TPSA | 20.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | 202 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.18 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[(2S)-1-(2,2,2-trifluoroethyl)pyrrolidin-2-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2S)-1-(2,2,2-trifluoroethyl)pyrrolidin-2-yl]ethanone?
The IUPAC name of 1-[(2S)-1-(2,2,2-trifluoroethyl)pyrrolidin-2-yl]ethanone (CID 89694527) is 1-[(2S)-1-(2,2,2-trifluoroethyl)pyrrolidin-2-yl]ethanone.
What is the SMILES notation for 1-[(2S)-1-(2,2,2-trifluoroethyl)pyrrolidin-2-yl]ethanone?
The canonical SMILES for 1-[(2S)-1-(2,2,2-trifluoroethyl)pyrrolidin-2-yl]ethanone is CC(=O)[C@@H]1CCCN1CC(F)(F)F.
What is the InChIKey of 1-[(2S)-1-(2,2,2-trifluoroethyl)pyrrolidin-2-yl]ethanone?
The InChIKey is XFDPMINGSHKVNA-ZETCQYMHSA-N. The full InChI is InChI=1S/C8H12F3NO/c1-6(13)7-3-2-4-12(7)5-8(9,10)11/h7H,2-5H2,1H3/t7-/m0/s1.
What are the key properties of 1-[(2S)-1-(2,2,2-trifluoroethyl)pyrrolidin-2-yl]ethanone?
1-[(2S)-1-(2,2,2-trifluoroethyl)pyrrolidin-2-yl]ethanone has a molecular weight of 195.18 g/mol, XLogP of 1.70, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2S)-1-(2,2,2-trifluoroethyl)pyrrolidin-2-yl]ethanone is sourced from PubChem (CID 89694527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).