About (2,6-dimethoxyphenyl)-(3,5-dimethylpyrazol-1-yl)methanone
(2,6-dimethoxyphenyl)-(3,5-dimethylpyrazol-1-yl)methanone (PubChem CID 897075) has the molecular formula C14H16N2O3
and a molecular weight of 260.29 g/mol. Its IUPAC name is (2,6-dimethoxyphenyl)-(3,5-dimethylpyrazol-1-yl)methanone.
Molecular Properties
| Compound Name | (2,6-dimethoxyphenyl)-(3,5-dimethylpyrazol-1-yl)methanone |
| PubChem CID | 897075 |
| Molecular Formula | C14H16N2O3 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | (2,6-dimethoxyphenyl)-(3,5-dimethylpyrazol-1-yl)methanone |
| SMILES | COc1cccc(OC)c1C(=O)n1nc(C)cc1C |
| InChI | InChI=1S/C14H16N2O3/c1-9-8-10(2)16(15-9)14(17)13-11(18-3)6-5-7-12(13)19-4/h5-8H,1-4H3 |
| InChIKey | DBYFOJXYZFYEFA-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2,6-dimethoxyphenyl)-(3,5-dimethylpyrazol-1-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,6-dimethoxyphenyl)-(3,5-dimethylpyrazol-1-yl)methanone?
The IUPAC name of (2,6-dimethoxyphenyl)-(3,5-dimethylpyrazol-1-yl)methanone (CID 897075) is (2,6-dimethoxyphenyl)-(3,5-dimethylpyrazol-1-yl)methanone.
What is the SMILES notation for (2,6-dimethoxyphenyl)-(3,5-dimethylpyrazol-1-yl)methanone?
The canonical SMILES for (2,6-dimethoxyphenyl)-(3,5-dimethylpyrazol-1-yl)methanone is COc1cccc(OC)c1C(=O)n1nc(C)cc1C.
What is the InChIKey of (2,6-dimethoxyphenyl)-(3,5-dimethylpyrazol-1-yl)methanone?
The InChIKey is DBYFOJXYZFYEFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N2O3/c1-9-8-10(2)16(15-9)14(17)13-11(18-3)6-5-7-12(13)19-4/h5-8H,1-4H3.
What are the key properties of (2,6-dimethoxyphenyl)-(3,5-dimethylpyrazol-1-yl)methanone?
(2,6-dimethoxyphenyl)-(3,5-dimethylpyrazol-1-yl)methanone has a molecular weight of 260.29 g/mol, XLogP of 2.21, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2,6-dimethoxyphenyl)-(3,5-dimethylpyrazol-1-yl)methanone is sourced from PubChem (CID 897075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).