C14H10Cl2FN3O — CID 8971589
N-[(Z)-1-(2,6-dichloro-3-fluorophenyl)ethylideneamino]pyridine-2-carboxamide (PubChem CID 8971589) has the molecular formula C14H10Cl2FN3O and a molecular weight of 326.16 g/mol. Its IUPAC name is N-[(Z)-1-(2,6-dichloro-3-fluorophenyl)ethylideneamino]pyridine-2-carboxamide.
| Compound Name | N-[(Z)-1-(2,6-dichloro-3-fluorophenyl)ethylideneamino]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 8971589 |
| Molecular Formula | C14H10Cl2FN3O |
| Molecular Weight | 326.16 g/mol |
| Exact Mass | 325.02 |
| IUPAC Name | N-[(Z)-1-(2,6-dichloro-3-fluorophenyl)ethylideneamino]pyridine-2-carboxamide |
| SMILES | C/C(=N/NC(=O)c1ccccn1)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C14H10Cl2FN3O/c1-8(12-9(15)5-6-10(17)13(12)16)19-20-14(21)11-4-2-3-7-18-11/h2-7H,1H3,(H,20,21)/b19-8- |
| InChIKey | GKKADDTWXQFCGD-UWVJOHFNSA-N |
| XLogP | 3.68 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.16 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|