C25H22N6O3S — CID 89726266
1-[2-[(2R)-4-[4-(1H-benzimidazol-2-yl)-1,3-thiazol-5-yl]-2-methylpiperazin-1-yl]-2-oxoethyl]indole-2,3-dione (PubChem CID 89726266) has the molecular formula C25H22N6O3S and a molecular weight of 486.50 g/mol. Its IUPAC name is 1-[2-[(2R)-4-[4-(1H-benzimidazol-2-yl)-1,3-thiazol-5-yl]-2-methylpiperazin-1-yl]-2-oxoethyl]indole-2,3-dione.
| Compound Name | 1-[2-[(2R)-4-[4-(1H-benzimidazol-2-yl)-1,3-thiazol-5-yl]-2-methylpiperazin-1-yl]-2-oxoethyl]indole-2,3-dione |
|---|---|
| PubChem CID | 89726266 |
| Molecular Formula | C25H22N6O3S |
| Molecular Weight | 486.50 g/mol |
| Exact Mass | 486.15 |
| IUPAC Name | 1-[2-[(2R)-4-[4-(1H-benzimidazol-2-yl)-1,3-thiazol-5-yl]-2-methylpiperazin-1-yl]-2-oxoethyl]indole-2,3-dione |
| SMILES | C[C@@H]1CN(CCN1C(=O)CN2C3=CC=CC=C3C(=O)C2=O)C4=C(N=CS4)C5=NC6=CC=CC=C6N5 |
| InChI | InChI=1S/C25H22N6O3S/c1-15-12-29(25-21(26-14-35-25)23-27-17-7-3-4-8-18(17)28-23)10-11-30(15)20(32)13-31-19-9-5-2-6-16(19)22(33)24(31)34/h2-9,14-15H,10-13H2,1H3,(H,27,28)/t15-/m1/s1 |
| InChIKey | VBPUTKIGVSGJSA-OAHLLOKOSA-N |
| XLogP | 3.10 |
| TPSA | 131.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | 859 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.50 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|