About ethyl N-[(Z)-[(2S)-2-phenyl-2,3-dihydrochromen-4-ylidene]amino]carbamate
ethyl N-[(Z)-[(2S)-2-phenyl-2,3-dihydrochromen-4-ylidene]amino]carbamate (PubChem CID 8972691) has the molecular formula C18H18N2O3
and a molecular weight of 310.35 g/mol. Its IUPAC name is ethyl N-[(Z)-[(2S)-2-phenyl-2,3-dihydrochromen-4-ylidene]amino]carbamate.
Molecular Properties
| Compound Name | ethyl N-[(Z)-[(2S)-2-phenyl-2,3-dihydrochromen-4-ylidene]amino]carbamate |
| PubChem CID | 8972691 |
| Molecular Formula | C18H18N2O3 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | ethyl N-[(Z)-[(2S)-2-phenyl-2,3-dihydrochromen-4-ylidene]amino]carbamate |
| SMILES | CCOC(=O)N/N=C1/C[C@@H](c2ccccc2)Oc2ccccc21 |
| InChI | InChI=1S/C18H18N2O3/c1-2-22-18(21)20-19-15-12-17(13-8-4-3-5-9-13)23-16-11-7-6-10-14(15)16/h3-11,17H,2,12H2,1H3,(H,20,21)/b19-15-/t17-/m0/s1 |
| InChIKey | FIXPPPDUJYMWFF-STZPCZCHSA-N |
| XLogP | 3.66 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl N-[(Z)-[(2S)-2-phenyl-2,3-dihydrochromen-4-ylidene]amino]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-[(Z)-[(2S)-2-phenyl-2,3-dihydrochromen-4-ylidene]amino]carbamate?
The IUPAC name of ethyl N-[(Z)-[(2S)-2-phenyl-2,3-dihydrochromen-4-ylidene]amino]carbamate (CID 8972691) is ethyl N-[(Z)-[(2S)-2-phenyl-2,3-dihydrochromen-4-ylidene]amino]carbamate.
What is the SMILES notation for ethyl N-[(Z)-[(2S)-2-phenyl-2,3-dihydrochromen-4-ylidene]amino]carbamate?
The canonical SMILES for ethyl N-[(Z)-[(2S)-2-phenyl-2,3-dihydrochromen-4-ylidene]amino]carbamate is CCOC(=O)N/N=C1/C[C@@H](c2ccccc2)Oc2ccccc21.
What is the InChIKey of ethyl N-[(Z)-[(2S)-2-phenyl-2,3-dihydrochromen-4-ylidene]amino]carbamate?
The InChIKey is FIXPPPDUJYMWFF-STZPCZCHSA-N. The full InChI is InChI=1S/C18H18N2O3/c1-2-22-18(21)20-19-15-12-17(13-8-4-3-5-9-13)23-16-11-7-6-10-14(15)16/h3-11,17H,2,12H2,1H3,(H,20,21)/b19-15-/t17-/m0/s1.
What are the key properties of ethyl N-[(Z)-[(2S)-2-phenyl-2,3-dihydrochromen-4-ylidene]amino]carbamate?
ethyl N-[(Z)-[(2S)-2-phenyl-2,3-dihydrochromen-4-ylidene]amino]carbamate has a molecular weight of 310.35 g/mol, XLogP of 3.66, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-[(Z)-[(2S)-2-phenyl-2,3-dihydrochromen-4-ylidene]amino]carbamate is sourced from PubChem (CID 8972691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).