About methyl 3-[(2,4-dimethoxybenzoyl)amino]thiophene-2-carboxylate
methyl 3-[(2,4-dimethoxybenzoyl)amino]thiophene-2-carboxylate (PubChem CID 897602) has the molecular formula C15H15NO5S
and a molecular weight of 321.35 g/mol. Its IUPAC name is methyl 3-[(2,4-dimethoxybenzoyl)amino]thiophene-2-carboxylate.
Molecular Properties
| Compound Name | methyl 3-[(2,4-dimethoxybenzoyl)amino]thiophene-2-carboxylate |
| PubChem CID | 897602 |
| Molecular Formula | C15H15NO5S |
| Molecular Weight | 321.35 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | methyl 3-[(2,4-dimethoxybenzoyl)amino]thiophene-2-carboxylate |
| SMILES | COC(=O)c1sccc1NC(=O)c1ccc(OC)cc1OC |
| InChI | InChI=1S/C15H15NO5S/c1-19-9-4-5-10(12(8-9)20-2)14(17)16-11-6-7-22-13(11)15(18)21-3/h4-8H,1-3H3,(H,16,17) |
| InChIKey | VGZCSROFTUEUEU-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.35 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 3-[(2,4-dimethoxybenzoyl)amino]thiophene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[(2,4-dimethoxybenzoyl)amino]thiophene-2-carboxylate?
The IUPAC name of methyl 3-[(2,4-dimethoxybenzoyl)amino]thiophene-2-carboxylate (CID 897602) is methyl 3-[(2,4-dimethoxybenzoyl)amino]thiophene-2-carboxylate.
What is the SMILES notation for methyl 3-[(2,4-dimethoxybenzoyl)amino]thiophene-2-carboxylate?
The canonical SMILES for methyl 3-[(2,4-dimethoxybenzoyl)amino]thiophene-2-carboxylate is COC(=O)c1sccc1NC(=O)c1ccc(OC)cc1OC.
What is the InChIKey of methyl 3-[(2,4-dimethoxybenzoyl)amino]thiophene-2-carboxylate?
The InChIKey is VGZCSROFTUEUEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15NO5S/c1-19-9-4-5-10(12(8-9)20-2)14(17)16-11-6-7-22-13(11)15(18)21-3/h4-8H,1-3H3,(H,16,17).
What are the key properties of methyl 3-[(2,4-dimethoxybenzoyl)amino]thiophene-2-carboxylate?
methyl 3-[(2,4-dimethoxybenzoyl)amino]thiophene-2-carboxylate has a molecular weight of 321.35 g/mol, XLogP of 2.80, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[(2,4-dimethoxybenzoyl)amino]thiophene-2-carboxylate is sourced from PubChem (CID 897602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).