C17H12ClN3O2 — CID 8977298
2-(2-chloro-4-cyanophenoxy)-N-[4-(cyanomethyl)phenyl]acetamide (PubChem CID 8977298) has the molecular formula C17H12ClN3O2 and a molecular weight of 325.76 g/mol. Its IUPAC name is 2-(2-chloro-4-cyanophenoxy)-N-[4-(cyanomethyl)phenyl]acetamide.
| Compound Name | 2-(2-chloro-4-cyanophenoxy)-N-[4-(cyanomethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 8977298 |
| Molecular Formula | C17H12ClN3O2 |
| Molecular Weight | 325.76 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | 2-(2-chloro-4-cyanophenoxy)-N-[4-(cyanomethyl)phenyl]acetamide |
| SMILES | N#CCc1ccc(NC(=O)COc2ccc(C#N)cc2Cl)cc1 |
| InChI | InChI=1S/C17H12ClN3O2/c18-15-9-13(10-20)3-6-16(15)23-11-17(22)21-14-4-1-12(2-5-14)7-8-19/h1-6,9H,7,11H2,(H,21,22) |
| InChIKey | DKBQQXDXRQRNOF-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 85.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.76 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |