C21H18FN5OS — CID 89777151
5-amino-N-[[4-(2-fluoro-3-pyridinyl)phenyl]methyl]-3,4-dimethylthieno[2,3-c]pyridazine-6-carboxamide (PubChem CID 89777151) has the molecular formula C21H18FN5OS and a molecular weight of 407.50 g/mol. Its IUPAC name is 5-amino-N-[[4-(2-fluoro-3-pyridinyl)phenyl]methyl]-3,4-dimethylthieno[2,3-c]pyridazine-6-carboxamide.
| Compound Name | 5-amino-N-[[4-(2-fluoro-3-pyridinyl)phenyl]methyl]-3,4-dimethylthieno[2,3-c]pyridazine-6-carboxamide |
|---|---|
| PubChem CID | 89777151 |
| Molecular Formula | C21H18FN5OS |
| Molecular Weight | 407.50 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | 5-amino-N-[[4-(2-fluoro-3-pyridinyl)phenyl]methyl]-3,4-dimethylthieno[2,3-c]pyridazine-6-carboxamide |
| SMILES | CC1=C(N=NC2=C1C(=C(S2)C(=O)NCC3=CC=C(C=C3)C4=C(N=CC=C4)F)N)C |
| InChI | InChI=1S/C21H18FN5OS/c1-11-12(2)26-27-21-16(11)17(23)18(29-21)20(28)25-10-13-5-7-14(8-6-13)15-4-3-9-24-19(15)22/h3-9H,10,23H2,1-2H3,(H,25,28) |
| InChIKey | BPGQEZBPFDQHIA-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 122.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | 575 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.50 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|