C20H25N3O4S — CID 8978679
5-(benzylsulfamoyl)-2-hydroxy-N-[(Z)-[(3R)-3-methylpentan-2-ylidene]amino]benzamide (PubChem CID 8978679) has the molecular formula C20H25N3O4S and a molecular weight of 403.50 g/mol. Its IUPAC name is 5-(benzylsulfamoyl)-2-hydroxy-N-[(Z)-[(3R)-3-methylpentan-2-ylidene]amino]benzamide.
| Compound Name | 5-(benzylsulfamoyl)-2-hydroxy-N-[(Z)-[(3R)-3-methylpentan-2-ylidene]amino]benzamide |
|---|---|
| PubChem CID | 8978679 |
| Molecular Formula | C20H25N3O4S |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | 5-(benzylsulfamoyl)-2-hydroxy-N-[(Z)-[(3R)-3-methylpentan-2-ylidene]amino]benzamide |
| SMILES | CC[C@@H](C)/C(C)=N\NC(=O)c1cc(S(=O)(=O)NCc2ccccc2)ccc1O |
| InChI | InChI=1S/C20H25N3O4S/c1-4-14(2)15(3)22-23-20(25)18-12-17(10-11-19(18)24)28(26,27)21-13-16-8-6-5-7-9-16/h5-12,14,21,24H,4,13H2,1-3H3,(H,23,25)/b22-15-/t14-/m1/s1 |
| InChIKey | GNZCJBQDHWVCKA-HHSBIGSDSA-N |
| XLogP | 3.02 |
| TPSA | 107.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|