C20H18FN3O2S — CID 8980245
2-(3-cyclopropyl-4-oxoquinazolin-2-yl)sulfanyl-N-(2-fluoro-4-methylphenyl)acetamide (PubChem CID 8980245) has the molecular formula C20H18FN3O2S and a molecular weight of 383.45 g/mol. Its IUPAC name is 2-(3-cyclopropyl-4-oxoquinazolin-2-yl)sulfanyl-N-(2-fluoro-4-methylphenyl)acetamide.
| Compound Name | 2-(3-cyclopropyl-4-oxoquinazolin-2-yl)sulfanyl-N-(2-fluoro-4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 8980245 |
| Molecular Formula | C20H18FN3O2S |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | 2-(3-cyclopropyl-4-oxoquinazolin-2-yl)sulfanyl-N-(2-fluoro-4-methylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)CSc2nc3ccccc3c(=O)n2C2CC2)c(F)c1 |
| InChI | InChI=1S/C20H18FN3O2S/c1-12-6-9-17(15(21)10-12)22-18(25)11-27-20-23-16-5-3-2-4-14(16)19(26)24(20)13-7-8-13/h2-6,9-10,13H,7-8,11H2,1H3,(H,22,25) |
| InChIKey | ZZOPGWIQQKZNAX-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |