C17H24N2O — CID 898213
cyclobutyl-[4-(2,5-dimethylphenyl)piperazin-1-yl]methanone (PubChem CID 898213) has the molecular formula C17H24N2O and a molecular weight of 272.39 g/mol. Its IUPAC name is cyclobutyl-[4-(2,5-dimethylphenyl)piperazin-1-yl]methanone.
| Compound Name | cyclobutyl-[4-(2,5-dimethylphenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 898213 |
| Molecular Formula | C17H24N2O |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | cyclobutyl-[4-(2,5-dimethylphenyl)piperazin-1-yl]methanone |
| SMILES | Cc1ccc(C)c(N2CCN(C(=O)C3CCC3)CC2)c1 |
| InChI | InChI=1S/C17H24N2O/c1-13-6-7-14(2)16(12-13)18-8-10-19(11-9-18)17(20)15-4-3-5-15/h6-7,12,15H,3-5,8-11H2,1-2H3 |
| InChIKey | JKPKYLXIPLAEDZ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |