About 5-methyl-N-(2-methyl-6-propan-2-ylphenyl)-3-phenyl-1,2-oxazole-4-carboxamide
5-methyl-N-(2-methyl-6-propan-2-ylphenyl)-3-phenyl-1,2-oxazole-4-carboxamide (PubChem CID 898330) has the molecular formula C21H22N2O2
and a molecular weight of 334.42 g/mol. Its IUPAC name is 5-methyl-N-(2-methyl-6-propan-2-ylphenyl)-3-phenyl-1,2-oxazole-4-carboxamide.
Molecular Properties
| Compound Name | 5-methyl-N-(2-methyl-6-propan-2-ylphenyl)-3-phenyl-1,2-oxazole-4-carboxamide |
| PubChem CID | 898330 |
| Molecular Formula | C21H22N2O2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | 5-methyl-N-(2-methyl-6-propan-2-ylphenyl)-3-phenyl-1,2-oxazole-4-carboxamide |
| SMILES | Cc1cccc(C(C)C)c1NC(=O)c1c(-c2ccccc2)noc1C |
| InChI | InChI=1S/C21H22N2O2/c1-13(2)17-12-8-9-14(3)19(17)22-21(24)18-15(4)25-23-20(18)16-10-6-5-7-11-16/h5-13H,1-4H3,(H,22,24) |
| InChIKey | WMAMIEZODHDKKA-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-methyl-N-(2-methyl-6-propan-2-ylphenyl)-3-phenyl-1,2-oxazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-N-(2-methyl-6-propan-2-ylphenyl)-3-phenyl-1,2-oxazole-4-carboxamide?
The IUPAC name of 5-methyl-N-(2-methyl-6-propan-2-ylphenyl)-3-phenyl-1,2-oxazole-4-carboxamide (CID 898330) is 5-methyl-N-(2-methyl-6-propan-2-ylphenyl)-3-phenyl-1,2-oxazole-4-carboxamide.
What is the SMILES notation for 5-methyl-N-(2-methyl-6-propan-2-ylphenyl)-3-phenyl-1,2-oxazole-4-carboxamide?
The canonical SMILES for 5-methyl-N-(2-methyl-6-propan-2-ylphenyl)-3-phenyl-1,2-oxazole-4-carboxamide is Cc1cccc(C(C)C)c1NC(=O)c1c(-c2ccccc2)noc1C.
What is the InChIKey of 5-methyl-N-(2-methyl-6-propan-2-ylphenyl)-3-phenyl-1,2-oxazole-4-carboxamide?
The InChIKey is WMAMIEZODHDKKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22N2O2/c1-13(2)17-12-8-9-14(3)19(17)22-21(24)18-15(4)25-23-20(18)16-10-6-5-7-11-16/h5-13H,1-4H3,(H,22,24).
What are the key properties of 5-methyl-N-(2-methyl-6-propan-2-ylphenyl)-3-phenyl-1,2-oxazole-4-carboxamide?
5-methyl-N-(2-methyl-6-propan-2-ylphenyl)-3-phenyl-1,2-oxazole-4-carboxamide has a molecular weight of 334.42 g/mol, XLogP of 5.33, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-N-(2-methyl-6-propan-2-ylphenyl)-3-phenyl-1,2-oxazole-4-carboxamide is sourced from PubChem (CID 898330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).