C21H25NO3 — CID 8983325
[2-(2,6-diethylanilino)-2-oxoethyl] 2-(2-methylphenyl)acetate (PubChem CID 8983325) has the molecular formula C21H25NO3 and a molecular weight of 339.44 g/mol. Its IUPAC name is [2-(2,6-diethylanilino)-2-oxoethyl] 2-(2-methylphenyl)acetate.
| Compound Name | [2-(2,6-diethylanilino)-2-oxoethyl] 2-(2-methylphenyl)acetate |
|---|---|
| PubChem CID | 8983325 |
| Molecular Formula | C21H25NO3 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | [2-(2,6-diethylanilino)-2-oxoethyl] 2-(2-methylphenyl)acetate |
| SMILES | CCc1cccc(CC)c1NC(=O)COC(=O)Cc1ccccc1C |
| InChI | InChI=1S/C21H25NO3/c1-4-16-11-8-12-17(5-2)21(16)22-19(23)14-25-20(24)13-18-10-7-6-9-15(18)3/h6-12H,4-5,13-14H2,1-3H3,(H,22,23) |
| InChIKey | MMTPBFNKXMVJOY-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |