About 2-methyl-N-(4-methyl-1,3-thiazol-2-yl)furan-3-carboxamide
2-methyl-N-(4-methyl-1,3-thiazol-2-yl)furan-3-carboxamide (PubChem CID 898753) has the molecular formula C10H10N2O2S
and a molecular weight of 222.27 g/mol. Its IUPAC name is 2-methyl-N-(4-methyl-1,3-thiazol-2-yl)furan-3-carboxamide.
Molecular Properties
| Compound Name | 2-methyl-N-(4-methyl-1,3-thiazol-2-yl)furan-3-carboxamide |
| PubChem CID | 898753 |
| Molecular Formula | C10H10N2O2S |
| Molecular Weight | 222.27 g/mol |
| Exact Mass | 222.05 |
| IUPAC Name | 2-methyl-N-(4-methyl-1,3-thiazol-2-yl)furan-3-carboxamide |
| SMILES | Cc1csc(NC(=O)c2ccoc2C)n1 |
| InChI | InChI=1S/C10H10N2O2S/c1-6-5-15-10(11-6)12-9(13)8-3-4-14-7(8)2/h3-5H,1-2H3,(H,11,12,13) |
| InChIKey | OGQPXXQSTQREPA-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.27 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methyl-N-(4-methyl-1,3-thiazol-2-yl)furan-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-N-(4-methyl-1,3-thiazol-2-yl)furan-3-carboxamide?
The IUPAC name of 2-methyl-N-(4-methyl-1,3-thiazol-2-yl)furan-3-carboxamide (CID 898753) is 2-methyl-N-(4-methyl-1,3-thiazol-2-yl)furan-3-carboxamide.
What is the SMILES notation for 2-methyl-N-(4-methyl-1,3-thiazol-2-yl)furan-3-carboxamide?
The canonical SMILES for 2-methyl-N-(4-methyl-1,3-thiazol-2-yl)furan-3-carboxamide is Cc1csc(NC(=O)c2ccoc2C)n1.
What is the InChIKey of 2-methyl-N-(4-methyl-1,3-thiazol-2-yl)furan-3-carboxamide?
The InChIKey is OGQPXXQSTQREPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O2S/c1-6-5-15-10(11-6)12-9(13)8-3-4-14-7(8)2/h3-5H,1-2H3,(H,11,12,13).
What are the key properties of 2-methyl-N-(4-methyl-1,3-thiazol-2-yl)furan-3-carboxamide?
2-methyl-N-(4-methyl-1,3-thiazol-2-yl)furan-3-carboxamide has a molecular weight of 222.27 g/mol, XLogP of 2.61, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-N-(4-methyl-1,3-thiazol-2-yl)furan-3-carboxamide is sourced from PubChem (CID 898753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).