About ethyl 3-[(4-ethyl-1,2,4-triazol-3-yl)sulfanylmethyl]-4-fluoro-1-benzothiophene-2-carboxylate
ethyl 3-[(4-ethyl-1,2,4-triazol-3-yl)sulfanylmethyl]-4-fluoro-1-benzothiophene-2-carboxylate (PubChem CID 8988449) has the molecular formula C16H16FN3O2S2
and a molecular weight of 365.46 g/mol. Its IUPAC name is ethyl 3-[(4-ethyl-1,2,4-triazol-3-yl)sulfanylmethyl]-4-fluoro-1-benzothiophene-2-carboxylate.
Molecular Properties
| Compound Name | ethyl 3-[(4-ethyl-1,2,4-triazol-3-yl)sulfanylmethyl]-4-fluoro-1-benzothiophene-2-carboxylate |
| PubChem CID | 8988449 |
| Molecular Formula | C16H16FN3O2S2 |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | ethyl 3-[(4-ethyl-1,2,4-triazol-3-yl)sulfanylmethyl]-4-fluoro-1-benzothiophene-2-carboxylate |
| SMILES | CCOC(=O)c1sc2cccc(F)c2c1CSc1nncn1CC |
| InChI | InChI=1S/C16H16FN3O2S2/c1-3-20-9-18-19-16(20)23-8-10-13-11(17)6-5-7-12(13)24-14(10)15(21)22-4-2/h5-7,9H,3-4,8H2,1-2H3 |
| InChIKey | KAMHEHMBXMIXCI-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze ethyl 3-[(4-ethyl-1,2,4-triazol-3-yl)sulfanylmethyl]-4-fluoro-1-benzothiophene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-[(4-ethyl-1,2,4-triazol-3-yl)sulfanylmethyl]-4-fluoro-1-benzothiophene-2-carboxylate?
The IUPAC name of ethyl 3-[(4-ethyl-1,2,4-triazol-3-yl)sulfanylmethyl]-4-fluoro-1-benzothiophene-2-carboxylate (CID 8988449) is ethyl 3-[(4-ethyl-1,2,4-triazol-3-yl)sulfanylmethyl]-4-fluoro-1-benzothiophene-2-carboxylate.
What is the SMILES notation for ethyl 3-[(4-ethyl-1,2,4-triazol-3-yl)sulfanylmethyl]-4-fluoro-1-benzothiophene-2-carboxylate?
The canonical SMILES for ethyl 3-[(4-ethyl-1,2,4-triazol-3-yl)sulfanylmethyl]-4-fluoro-1-benzothiophene-2-carboxylate is CCOC(=O)c1sc2cccc(F)c2c1CSc1nncn1CC.
What is the InChIKey of ethyl 3-[(4-ethyl-1,2,4-triazol-3-yl)sulfanylmethyl]-4-fluoro-1-benzothiophene-2-carboxylate?
The InChIKey is KAMHEHMBXMIXCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16FN3O2S2/c1-3-20-9-18-19-16(20)23-8-10-13-11(17)6-5-7-12(13)24-14(10)15(21)22-4-2/h5-7,9H,3-4,8H2,1-2H3.
What are the key properties of ethyl 3-[(4-ethyl-1,2,4-triazol-3-yl)sulfanylmethyl]-4-fluoro-1-benzothiophene-2-carboxylate?
ethyl 3-[(4-ethyl-1,2,4-triazol-3-yl)sulfanylmethyl]-4-fluoro-1-benzothiophene-2-carboxylate has a molecular weight of 365.46 g/mol, XLogP of 4.12, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-[(4-ethyl-1,2,4-triazol-3-yl)sulfanylmethyl]-4-fluoro-1-benzothiophene-2-carboxylate is sourced from PubChem (CID 8988449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).