C17H17ClN2O3S — CID 8988629
(2S)-N-(2-chloro-3-pyridinyl)-2-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfanyl)propanamide (PubChem CID 8988629) has the molecular formula C17H17ClN2O3S and a molecular weight of 364.85 g/mol. Its IUPAC name is (2S)-N-(2-chloro-3-pyridinyl)-2-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfanyl)propanamide.
| Compound Name | (2S)-N-(2-chloro-3-pyridinyl)-2-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfanyl)propanamide |
|---|---|
| PubChem CID | 8988629 |
| Molecular Formula | C17H17ClN2O3S |
| Molecular Weight | 364.85 g/mol |
| Exact Mass | 364.06 |
| IUPAC Name | (2S)-N-(2-chloro-3-pyridinyl)-2-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfanyl)propanamide |
| SMILES | C[C@H](Sc1ccc2c(c1)OCCCO2)C(=O)Nc1cccnc1Cl |
| InChI | InChI=1S/C17H17ClN2O3S/c1-11(17(21)20-13-4-2-7-19-16(13)18)24-12-5-6-14-15(10-12)23-9-3-8-22-14/h2,4-7,10-11H,3,8-9H2,1H3,(H,20,21)/t11-/m0/s1 |
| InChIKey | SVXXNASWJBIDOO-NSHDSACASA-N |
| XLogP | 4.02 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.85 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|