C22H27N3O3 — CID 8988802
N-(2,6-diethylphenyl)-N'-[(Z)-(2-propoxyphenyl)methylideneamino]oxamide (PubChem CID 8988802) has the molecular formula C22H27N3O3 and a molecular weight of 381.48 g/mol. Its IUPAC name is N-(2,6-diethylphenyl)-N'-[(Z)-(2-propoxyphenyl)methylideneamino]oxamide.
| Compound Name | N-(2,6-diethylphenyl)-N'-[(Z)-(2-propoxyphenyl)methylideneamino]oxamide |
|---|---|
| PubChem CID | 8988802 |
| Molecular Formula | C22H27N3O3 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | N-(2,6-diethylphenyl)-N'-[(Z)-(2-propoxyphenyl)methylideneamino]oxamide |
| SMILES | CCCOc1ccccc1/C=N\NC(=O)C(=O)Nc1c(CC)cccc1CC |
| InChI | InChI=1S/C22H27N3O3/c1-4-14-28-19-13-8-7-10-18(19)15-23-25-22(27)21(26)24-20-16(5-2)11-9-12-17(20)6-3/h7-13,15H,4-6,14H2,1-3H3,(H,24,26)(H,25,27)/b23-15- |
| InChIKey | QTEQWISDPGBREJ-HAHDFKILSA-N |
| XLogP | 3.69 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|