C18H13NO4 — CID 898935
methyl 2-(1,3-benzodioxol-5-yl)quinoline-4-carboxylate (PubChem CID 898935) has the molecular formula C18H13NO4 and a molecular weight of 307.31 g/mol. Its IUPAC name is methyl 2-(1,3-benzodioxol-5-yl)quinoline-4-carboxylate.
| Compound Name | methyl 2-(1,3-benzodioxol-5-yl)quinoline-4-carboxylate |
|---|---|
| PubChem CID | 898935 |
| Molecular Formula | C18H13NO4 |
| Molecular Weight | 307.31 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | methyl 2-(1,3-benzodioxol-5-yl)quinoline-4-carboxylate |
| SMILES | COC(=O)c1cc(-c2ccc3c(c2)OCO3)nc2ccccc12 |
| InChI | InChI=1S/C18H13NO4/c1-21-18(20)13-9-15(19-14-5-3-2-4-12(13)14)11-6-7-16-17(8-11)23-10-22-16/h2-9H,10H2,1H3 |
| InChIKey | RTRVTKGGQPRLBL-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.31 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |