C23H25N4O3+ — CID 8990410
(5Z)-5-[(4-benzylpiperazin-4-ium-1-yl)methylidene]-1-(2-methylphenyl)-1,3-diazinane-2,4,6-trione (PubChem CID 8990410) has the molecular formula C23H25N4O3+ and a molecular weight of 405.48 g/mol. Its IUPAC name is (5Z)-5-[(4-benzylpiperazin-4-ium-1-yl)methylidene]-1-(2-methylphenyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | (5Z)-5-[(4-benzylpiperazin-4-ium-1-yl)methylidene]-1-(2-methylphenyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 8990410 |
| Molecular Formula | C23H25N4O3+ |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | (5Z)-5-[(4-benzylpiperazin-4-ium-1-yl)methylidene]-1-(2-methylphenyl)-1,3-diazinane-2,4,6-trione |
| SMILES | Cc1ccccc1N1C(=O)NC(=O)/C(=C/N2CC[NH+](Cc3ccccc3)CC2)C1=O |
| InChI | InChI=1S/C23H24N4O3/c1-17-7-5-6-10-20(17)27-22(29)19(21(28)24-23(27)30)16-26-13-11-25(12-14-26)15-18-8-3-2-4-9-18/h2-10,16H,11-15H2,1H3,(H,24,28,30)/p+1/b19-16- |
| InChIKey | CNCFCOYLXVUVKE-MNDPQUGUSA-O |
| XLogP | 0.86 |
| TPSA | 74.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|