About 6-(2-ethoxyphenyl)-3,8-dimethylpteridine-2,4-dione
6-(2-ethoxyphenyl)-3,8-dimethylpteridine-2,4-dione (PubChem CID 8990439) has the molecular formula C16H16N4O3
and a molecular weight of 312.33 g/mol. Its IUPAC name is 6-(2-ethoxyphenyl)-3,8-dimethylpteridine-2,4-dione.
Molecular Properties
| Compound Name | 6-(2-ethoxyphenyl)-3,8-dimethylpteridine-2,4-dione |
| PubChem CID | 8990439 |
| Molecular Formula | C16H16N4O3 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | 6-(2-ethoxyphenyl)-3,8-dimethylpteridine-2,4-dione |
| SMILES | CCOc1ccccc1-c1cn(C)c2nc(=O)n(C)c(=O)c-2n1 |
| InChI | InChI=1S/C16H16N4O3/c1-4-23-12-8-6-5-7-10(12)11-9-19(2)14-13(17-11)15(21)20(3)16(22)18-14/h5-9H,4H2,1-3H3 |
| InChIKey | JJUIVXLYHOLWOR-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 79.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 6-(2-ethoxyphenyl)-3,8-dimethylpteridine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2-ethoxyphenyl)-3,8-dimethylpteridine-2,4-dione?
The IUPAC name of 6-(2-ethoxyphenyl)-3,8-dimethylpteridine-2,4-dione (CID 8990439) is 6-(2-ethoxyphenyl)-3,8-dimethylpteridine-2,4-dione.
What is the SMILES notation for 6-(2-ethoxyphenyl)-3,8-dimethylpteridine-2,4-dione?
The canonical SMILES for 6-(2-ethoxyphenyl)-3,8-dimethylpteridine-2,4-dione is CCOc1ccccc1-c1cn(C)c2nc(=O)n(C)c(=O)c-2n1.
What is the InChIKey of 6-(2-ethoxyphenyl)-3,8-dimethylpteridine-2,4-dione?
The InChIKey is JJUIVXLYHOLWOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N4O3/c1-4-23-12-8-6-5-7-10(12)11-9-19(2)14-13(17-11)15(21)20(3)16(22)18-14/h5-9H,4H2,1-3H3.
What are the key properties of 6-(2-ethoxyphenyl)-3,8-dimethylpteridine-2,4-dione?
6-(2-ethoxyphenyl)-3,8-dimethylpteridine-2,4-dione has a molecular weight of 312.33 g/mol, XLogP of 1.04, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2-ethoxyphenyl)-3,8-dimethylpteridine-2,4-dione is sourced from PubChem (CID 8990439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).