C23H26N2OS — CID 8990679
(5Z)-5-[(4-tert-butylphenyl)methylidene]-2-(2-ethylphenyl)imino-3-methyl-1,3-thiazolidin-4-one (PubChem CID 8990679) has the molecular formula C23H26N2OS and a molecular weight of 378.54 g/mol. Its IUPAC name is (5Z)-5-[(4-tert-butylphenyl)methylidene]-2-(2-ethylphenyl)imino-3-methyl-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[(4-tert-butylphenyl)methylidene]-2-(2-ethylphenyl)imino-3-methyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 8990679 |
| Molecular Formula | C23H26N2OS |
| Molecular Weight | 378.54 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | (5Z)-5-[(4-tert-butylphenyl)methylidene]-2-(2-ethylphenyl)imino-3-methyl-1,3-thiazolidin-4-one |
| SMILES | CCc1ccccc1/N=C1/S/C(=C\c2ccc(C(C)(C)C)cc2)C(=O)N1C |
| InChI | InChI=1S/C23H26N2OS/c1-6-17-9-7-8-10-19(17)24-22-25(5)21(26)20(27-22)15-16-11-13-18(14-12-16)23(2,3)4/h7-15H,6H2,1-5H3/b20-15-,24-22+ |
| InChIKey | HBTVWVZISCFMDT-PRMAFZJDSA-N |
| XLogP | 5.78 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.54 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|