C23H16N2O4 — CID 8991325
(4S)-1-[2-(2-oxobenzo[cd]indol-1-yl)acetyl]-4-phenylpyrrolidine-2,3-dione (PubChem CID 8991325) has the molecular formula C23H16N2O4 and a molecular weight of 384.39 g/mol. Its IUPAC name is (4S)-1-[2-(2-oxobenzo[cd]indol-1-yl)acetyl]-4-phenylpyrrolidine-2,3-dione.
| Compound Name | (4S)-1-[2-(2-oxobenzo[cd]indol-1-yl)acetyl]-4-phenylpyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 8991325 |
| Molecular Formula | C23H16N2O4 |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | (4S)-1-[2-(2-oxobenzo[cd]indol-1-yl)acetyl]-4-phenylpyrrolidine-2,3-dione |
| SMILES | O=C1C(=O)N(C(=O)CN2C(=O)c3cccc4cccc2c34)C[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C23H16N2O4/c26-19(25-12-17(21(27)23(25)29)14-6-2-1-3-7-14)13-24-18-11-5-9-15-8-4-10-16(20(15)18)22(24)28/h1-11,17H,12-13H2/t17-/m1/s1 |
| InChIKey | QVDULGHRNQMJRL-QGZVFWFLSA-N |
| XLogP | 2.52 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|