C22H22N2O2 — CID 899152
[2-(2,5-dimethylphenyl)quinolin-4-yl]-morpholin-4-ylmethanone (PubChem CID 899152) has the molecular formula C22H22N2O2 and a molecular weight of 346.43 g/mol. Its IUPAC name is [2-(2,5-dimethylphenyl)quinolin-4-yl]-morpholin-4-ylmethanone.
| Compound Name | [2-(2,5-dimethylphenyl)quinolin-4-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 899152 |
| Molecular Formula | C22H22N2O2 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | [2-(2,5-dimethylphenyl)quinolin-4-yl]-morpholin-4-ylmethanone |
| SMILES | Cc1ccc(C)c(-c2cc(C(=O)N3CCOCC3)c3ccccc3n2)c1 |
| InChI | InChI=1S/C22H22N2O2/c1-15-7-8-16(2)18(13-15)21-14-19(17-5-3-4-6-20(17)23-21)22(25)24-9-11-26-12-10-24/h3-8,13-14H,9-12H2,1-2H3 |
| InChIKey | NDDDEKGEJNMNDD-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |