C23H32N2O2 — CID 8992802
2-[[(1S)-1-(4-ethylphenyl)-2-methylpropyl]amino]-N-[2-(2-methoxyphenyl)ethyl]acetamide (PubChem CID 8992802) has the molecular formula C23H32N2O2 and a molecular weight of 368.52 g/mol. Its IUPAC name is 2-[[(1S)-1-(4-ethylphenyl)-2-methylpropyl]amino]-N-[2-(2-methoxyphenyl)ethyl]acetamide.
| Compound Name | 2-[[(1S)-1-(4-ethylphenyl)-2-methylpropyl]amino]-N-[2-(2-methoxyphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 8992802 |
| Molecular Formula | C23H32N2O2 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.25 |
| IUPAC Name | 2-[[(1S)-1-(4-ethylphenyl)-2-methylpropyl]amino]-N-[2-(2-methoxyphenyl)ethyl]acetamide |
| SMILES | CCc1ccc([C@@H](NCC(=O)NCCc2ccccc2OC)C(C)C)cc1 |
| InChI | InChI=1S/C23H32N2O2/c1-5-18-10-12-20(13-11-18)23(17(2)3)25-16-22(26)24-15-14-19-8-6-7-9-21(19)27-4/h6-13,17,23,25H,5,14-16H2,1-4H3,(H,24,26)/t23-/m0/s1 |
| InChIKey | BZXJLQYUXHFITO-QHCPKHFHSA-N |
| XLogP | 3.90 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |