C24H32N2O3 — CID 8993026
2-(6,7-diethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-N-(3-phenylpropyl)acetamide (PubChem CID 8993026) has the molecular formula C24H32N2O3 and a molecular weight of 396.53 g/mol. Its IUPAC name is 2-(6,7-diethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-N-(3-phenylpropyl)acetamide.
| Compound Name | 2-(6,7-diethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-N-(3-phenylpropyl)acetamide |
|---|---|
| PubChem CID | 8993026 |
| Molecular Formula | C24H32N2O3 |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.24 |
| IUPAC Name | 2-(6,7-diethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-N-(3-phenylpropyl)acetamide |
| SMILES | CCOc1cc2c(cc1OCC)CN(CC(=O)NCCCc1ccccc1)CC2 |
| InChI | InChI=1S/C24H32N2O3/c1-3-28-22-15-20-12-14-26(17-21(20)16-23(22)29-4-2)18-24(27)25-13-8-11-19-9-6-5-7-10-19/h5-7,9-10,15-16H,3-4,8,11-14,17-18H2,1-2H3,(H,25,27) |
| InChIKey | NTULZUUZMDZWDY-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|