C24H36N2O5 — CID 8994150
[(2R)-1-(4-benzylpiperidin-1-yl)-1-oxopropan-2-yl] 4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate (PubChem CID 8994150) has the molecular formula C24H36N2O5 and a molecular weight of 432.56 g/mol. Its IUPAC name is [(2R)-1-(4-benzylpiperidin-1-yl)-1-oxopropan-2-yl] 4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate.
| Compound Name | [(2R)-1-(4-benzylpiperidin-1-yl)-1-oxopropan-2-yl] 4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
|---|---|
| PubChem CID | 8994150 |
| Molecular Formula | C24H36N2O5 |
| Molecular Weight | 432.56 g/mol |
| Exact Mass | 432.26 |
| IUPAC Name | [(2R)-1-(4-benzylpiperidin-1-yl)-1-oxopropan-2-yl] 4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
| SMILES | C[C@@H](OC(=O)CCCNC(=O)OC(C)(C)C)C(=O)N1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C24H36N2O5/c1-18(30-21(27)11-8-14-25-23(29)31-24(2,3)4)22(28)26-15-12-20(13-16-26)17-19-9-6-5-7-10-19/h5-7,9-10,18,20H,8,11-17H2,1-4H3,(H,25,29)/t18-/m1/s1 |
| InChIKey | NKRCHRRKDUTAAN-GOSISDBHSA-N |
| XLogP | 3.70 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.56 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|