C21H32N3O4S+ — CID 8995340
[1-[(3S)-1,1-dioxothiolan-3-yl]-3,5-dimethylpyrazol-4-yl]methyl-[3-(4-methoxyphenoxy)propyl]-methylazanium (PubChem CID 8995340) has the molecular formula C21H32N3O4S+ and a molecular weight of 422.57 g/mol. Its IUPAC name is [1-[(3S)-1,1-dioxothiolan-3-yl]-3,5-dimethylpyrazol-4-yl]methyl-[3-(4-methoxyphenoxy)propyl]-methylazanium.
| Compound Name | [1-[(3S)-1,1-dioxothiolan-3-yl]-3,5-dimethylpyrazol-4-yl]methyl-[3-(4-methoxyphenoxy)propyl]-methylazanium |
|---|---|
| PubChem CID | 8995340 |
| Molecular Formula | C21H32N3O4S+ |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | [1-[(3S)-1,1-dioxothiolan-3-yl]-3,5-dimethylpyrazol-4-yl]methyl-[3-(4-methoxyphenoxy)propyl]-methylazanium |
| SMILES | COc1ccc(OCCC[NH+](C)Cc2c(C)nn([C@H]3CCS(=O)(=O)C3)c2C)cc1 |
| InChI | InChI=1S/C21H31N3O4S/c1-16-21(17(2)24(22-16)18-10-13-29(25,26)15-18)14-23(3)11-5-12-28-20-8-6-19(27-4)7-9-20/h6-9,18H,5,10-15H2,1-4H3/p+1/t18-/m0/s1 |
| InChIKey | ZERBQDIEDCTRBW-SFHVURJKSA-O |
| XLogP | 1.35 |
| TPSA | 74.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|