C13H12N2O2 — CID 899773
3-methyl-1,4-dihydropyridazino[1,2-b]phthalazine-6,11-dione (PubChem CID 899773) has the molecular formula C13H12N2O2 and a molecular weight of 228.25 g/mol. Its IUPAC name is 3-methyl-1,4-dihydropyridazino[1,2-b]phthalazine-6,11-dione.
| Compound Name | 3-methyl-1,4-dihydropyridazino[1,2-b]phthalazine-6,11-dione |
|---|---|
| PubChem CID | 899773 |
| Molecular Formula | C13H12N2O2 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | 3-methyl-1,4-dihydropyridazino[1,2-b]phthalazine-6,11-dione |
| SMILES | CC1=CCn2c(=O)c3ccccc3c(=O)n2C1 |
| InChI | InChI=1S/C13H12N2O2/c1-9-6-7-14-12(16)10-4-2-3-5-11(10)13(17)15(14)8-9/h2-6H,7-8H2,1H3 |
| InChIKey | GDWFDKOUGCYTFH-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|