About butane-1,2,3,4-tetrol
butane-1,2,3,4-tetrol (PubChem CID 8998) has the molecular formula C4H10O4
and a molecular weight of 122.12 g/mol. Its IUPAC name is butane-1,2,3,4-tetrol.
Molecular Properties
| Compound Name | butane-1,2,3,4-tetrol |
| PubChem CID | 8998 |
| Molecular Formula | C4H10O4 |
| Molecular Weight | 122.12 g/mol |
| Exact Mass | 122.06 |
| IUPAC Name | butane-1,2,3,4-tetrol |
| SMILES | OCC(O)C(O)CO |
| InChI | InChI=1S/C4H10O4/c5-1-3(7)4(8)2-6/h3-8H,1-2H2 |
| InChIKey | UNXHWFMMPAWVPI-UHFFFAOYSA-N |
| XLogP | -2.31 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.12 |
| LogP ≤ 5 | -2.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze butane-1,2,3,4-tetrol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane-1,2,3,4-tetrol?
The IUPAC name of butane-1,2,3,4-tetrol (CID 8998) is butane-1,2,3,4-tetrol.
What is the SMILES notation for butane-1,2,3,4-tetrol?
The canonical SMILES for butane-1,2,3,4-tetrol is OCC(O)C(O)CO.
What is the InChIKey of butane-1,2,3,4-tetrol?
The InChIKey is UNXHWFMMPAWVPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10O4/c5-1-3(7)4(8)2-6/h3-8H,1-2H2.
What are the key properties of butane-1,2,3,4-tetrol?
butane-1,2,3,4-tetrol has a molecular weight of 122.12 g/mol, XLogP of -2.31, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for butane-1,2,3,4-tetrol is sourced from PubChem (CID 8998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).