About 9-nitrosocarbazole
9-nitrosocarbazole (PubChem CID 17743) has the molecular formula C12H8N2O
and a molecular weight of 196.21 g/mol. Its IUPAC name is 9-nitrosocarbazole.
Molecular Properties
| Compound Name | 9-nitrosocarbazole |
| PubChem CID | 17743 |
| Molecular Formula | C12H8N2O |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.06 |
| IUPAC Name | 9-nitrosocarbazole |
| SMILES | O=Nn1c2ccccc2c2ccccc21 |
| InChI | InChI=1S/C12H8N2O/c15-13-14-11-7-3-1-5-9(11)10-6-2-4-8-12(10)14/h1-8H |
| InChIKey | XPKSVCWBMBPUPE-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|
Analyze 9-nitrosocarbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-nitrosocarbazole?
The IUPAC name of 9-nitrosocarbazole (CID 17743) is 9-nitrosocarbazole.
What is the SMILES notation for 9-nitrosocarbazole?
The canonical SMILES for 9-nitrosocarbazole is O=Nn1c2ccccc2c2ccccc21.
What is the InChIKey of 9-nitrosocarbazole?
The InChIKey is XPKSVCWBMBPUPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8N2O/c15-13-14-11-7-3-1-5-9(11)10-6-2-4-8-12(10)14/h1-8H.
What are the key properties of 9-nitrosocarbazole?
9-nitrosocarbazole has a molecular weight of 196.21 g/mol, XLogP of 3.32, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-nitrosocarbazole is sourced from PubChem (CID 17743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).