C27H30O15 — CID 90000166
2-(3,4-dihydroxyphenyl)-5-hydroxy-3,7-bis[[(3S,4S,5S,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxy]chromen-4-one (PubChem CID 90000166) has the molecular formula C27H30O15 and a molecular weight of 594.52 g/mol. Its IUPAC name is 2-(3,4-dihydroxyphenyl)-5-hydroxy-3,7-bis[[(3S,4S,5S,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxy]chromen-4-one.
| Compound Name | 2-(3,4-dihydroxyphenyl)-5-hydroxy-3,7-bis[[(3S,4S,5S,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxy]chromen-4-one |
|---|---|
| PubChem CID | 90000166 |
| Molecular Formula | C27H30O15 |
| Molecular Weight | 594.52 g/mol |
| Exact Mass | 594.16 |
| IUPAC Name | 2-(3,4-dihydroxyphenyl)-5-hydroxy-3,7-bis[[(3S,4S,5S,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxy]chromen-4-one |
| SMILES | C[C@H]1OC(Oc2c(-c3ccc(O)c(O)c3)oc3cc(OC4O[C@H](C)[C@@H](O)C(O)[C@@H]4O)cc(O)c3c2=O)[C@@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C27H30O15/c1-8-17(31)20(34)22(36)26(38-8)40-11-6-14(30)16-15(7-11)41-24(10-3-4-12(28)13(29)5-10)25(19(16)33)42-27-23(37)21(35)18(32)9(2)39-27/h3-9,17-18,20-23,26-32,34-37H,1-2H3/t8-,9-,17-,18-,20?,21+,22+,23+,26?,27?/m1/s1 |
| InChIKey | GXLQUHPXGLZNGE-RGJWQZMJSA-N |
| XLogP | -1.01 |
| TPSA | 249.20 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.52 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|