About 1,1,2,2-tetrachloroethane;hydrate
1,1,2,2-tetrachloroethane;hydrate (PubChem CID 90001124) has the molecular formula C2H4Cl4O
and a molecular weight of 185.87 g/mol. Its IUPAC name is 1,1,2,2-tetrachloroethane;hydrate.
Molecular Properties
| Compound Name | 1,1,2,2-tetrachloroethane;hydrate |
| PubChem CID | 90001124 |
| Molecular Formula | C2H4Cl4O |
| Molecular Weight | 185.87 g/mol |
| Exact Mass | 183.90 |
| IUPAC Name | 1,1,2,2-tetrachloroethane;hydrate |
| SMILES | ClC(Cl)C(Cl)Cl.O |
| InChI | InChI=1S/C2H2Cl4.H2O/c3-1(4)2(5)6;/h1-2H;1H2 |
| InChIKey | QMZRDKAPRYYXRU-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 31.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.87 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1,1,2,2-tetrachloroethane;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1,2,2-tetrachloroethane;hydrate?
The IUPAC name of 1,1,2,2-tetrachloroethane;hydrate (CID 90001124) is 1,1,2,2-tetrachloroethane;hydrate.
What is the SMILES notation for 1,1,2,2-tetrachloroethane;hydrate?
The canonical SMILES for 1,1,2,2-tetrachloroethane;hydrate is ClC(Cl)C(Cl)Cl.O.
What is the InChIKey of 1,1,2,2-tetrachloroethane;hydrate?
The InChIKey is QMZRDKAPRYYXRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H2Cl4.H2O/c3-1(4)2(5)6;/h1-2H;1H2.
What are the key properties of 1,1,2,2-tetrachloroethane;hydrate?
1,1,2,2-tetrachloroethane;hydrate has a molecular weight of 185.87 g/mol, XLogP of 1.77, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1,2,2-tetrachloroethane;hydrate is sourced from PubChem (CID 90001124), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).