C10H4F5NO2S — CID 90001536
2-(1,1,2,2,2-pentafluoroethyl)-1,3-benzothiazole-4-carboxylic acid (PubChem CID 90001536) has the molecular formula C10H4F5NO2S and a molecular weight of 297.20 g/mol. Its IUPAC name is 2-(1,1,2,2,2-pentafluoroethyl)-1,3-benzothiazole-4-carboxylic acid.
| Compound Name | 2-(1,1,2,2,2-pentafluoroethyl)-1,3-benzothiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 90001536 |
| Molecular Formula | C10H4F5NO2S |
| Molecular Weight | 297.20 g/mol |
| Exact Mass | 296.99 |
| IUPAC Name | 2-(1,1,2,2,2-pentafluoroethyl)-1,3-benzothiazole-4-carboxylic acid |
| SMILES | O=C(O)c1cccc2sc(C(F)(F)C(F)(F)F)nc12 |
| InChI | InChI=1S/C10H4F5NO2S/c11-9(12,10(13,14)15)8-16-6-4(7(17)18)2-1-3-5(6)19-8/h1-3H,(H,17,18) |
| InChIKey | YMYZBEVVSFCPHG-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.20 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|