C10H4F5NO3S — CID 90001538
[2-(1,1,2,2,2-pentafluoroethyl)-1,3-benzothiazol-4-yl] hydrogen carbonate (PubChem CID 90001538) has the molecular formula C10H4F5NO3S and a molecular weight of 313.20 g/mol. Its IUPAC name is [2-(1,1,2,2,2-pentafluoroethyl)-1,3-benzothiazol-4-yl] hydrogen carbonate.
| Compound Name | [2-(1,1,2,2,2-pentafluoroethyl)-1,3-benzothiazol-4-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 90001538 |
| Molecular Formula | C10H4F5NO3S |
| Molecular Weight | 313.20 g/mol |
| Exact Mass | 312.98 |
| IUPAC Name | [2-(1,1,2,2,2-pentafluoroethyl)-1,3-benzothiazol-4-yl] hydrogen carbonate |
| SMILES | O=C(O)Oc1cccc2sc(C(F)(F)C(F)(F)F)nc12 |
| InChI | InChI=1S/C10H4F5NO3S/c11-9(12,10(13,14)15)7-16-6-4(19-8(17)18)2-1-3-5(6)20-7/h1-3H,(H,17,18) |
| InChIKey | DBGOVXPCKPBAMM-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.20 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|