C21H15Cl3F3NO2 — CID 90001807
6-[2-(3,4,5-trichlorophenyl)-2-(trifluoromethyl)-3H-furan-4-yl]spiro[1H-2-benzofuran-3,3'-azetidine] (PubChem CID 90001807) has the molecular formula C21H15Cl3F3NO2 and a molecular weight of 476.71 g/mol. Its IUPAC name is 6-[2-(3,4,5-trichlorophenyl)-2-(trifluoromethyl)-3H-furan-4-yl]spiro[1H-2-benzofuran-3,3'-azetidine].
| Compound Name | 6-[2-(3,4,5-trichlorophenyl)-2-(trifluoromethyl)-3H-furan-4-yl]spiro[1H-2-benzofuran-3,3'-azetidine] |
|---|---|
| PubChem CID | 90001807 |
| Molecular Formula | C21H15Cl3F3NO2 |
| Molecular Weight | 476.71 g/mol |
| Exact Mass | 475.01 |
| IUPAC Name | 6-[2-(3,4,5-trichlorophenyl)-2-(trifluoromethyl)-3H-furan-4-yl]spiro[1H-2-benzofuran-3,3'-azetidine] |
| SMILES | FC(F)(F)C1(c2cc(Cl)c(Cl)c(Cl)c2)CC(c2ccc3c(c2)COC32CNC2)=CO1 |
| InChI | InChI=1S/C21H15Cl3F3NO2/c22-16-4-14(5-17(23)18(16)24)20(21(25,26)27)6-13(8-30-20)11-1-2-15-12(3-11)7-29-19(15)9-28-10-19/h1-5,8,28H,6-7,9-10H2 |
| InChIKey | ZHHJRUYMLUCLLA-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.71 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|