About (3S)-3-(4-bromophenyl)-N,N-dimethyl-3-pyridin-2-ylpropan-1-amine
(3S)-3-(4-bromophenyl)-N,N-dimethyl-3-pyridin-2-ylpropan-1-amine (PubChem CID 90001961) has the molecular formula C32H38Br2N4
and a molecular weight of 638.49 g/mol. Its IUPAC name is (3S)-3-(4-bromophenyl)-N,N-dimethyl-3-pyridin-2-ylpropan-1-amine.
Molecular Properties
| Compound Name | (3S)-3-(4-bromophenyl)-N,N-dimethyl-3-pyridin-2-ylpropan-1-amine |
| PubChem CID | 90001961 |
| Molecular Formula | C32H38Br2N4 |
| Molecular Weight | 638.49 g/mol |
| Exact Mass | 636.15 |
| IUPAC Name | (3S)-3-(4-bromophenyl)-N,N-dimethyl-3-pyridin-2-ylpropan-1-amine |
| SMILES | CN(C)CC[C@@H](c1ccc(Br)cc1)c1ccccn1.CN(C)CC[C@@H](c1ccc(Br)cc1)c1ccccn1 |
| InChI | InChI=1S/2C16H19BrN2/c2*1-19(2)12-10-15(16-5-3-4-11-18-16)13-6-8-14(17)9-7-13/h2*3-9,11,15H,10,12H2,1-2H3/t2*15-/m00/s1 |
| InChIKey | FECXXVGLDSSIGK-HJIBXMCBSA-N |
| XLogP | 7.86 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 638.49 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3S)-3-(4-bromophenyl)-N,N-dimethyl-3-pyridin-2-ylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-(4-bromophenyl)-N,N-dimethyl-3-pyridin-2-ylpropan-1-amine?
The IUPAC name of (3S)-3-(4-bromophenyl)-N,N-dimethyl-3-pyridin-2-ylpropan-1-amine (CID 90001961) is (3S)-3-(4-bromophenyl)-N,N-dimethyl-3-pyridin-2-ylpropan-1-amine.
What is the SMILES notation for (3S)-3-(4-bromophenyl)-N,N-dimethyl-3-pyridin-2-ylpropan-1-amine?
The canonical SMILES for (3S)-3-(4-bromophenyl)-N,N-dimethyl-3-pyridin-2-ylpropan-1-amine is CN(C)CC[C@@H](c1ccc(Br)cc1)c1ccccn1.CN(C)CC[C@@H](c1ccc(Br)cc1)c1ccccn1.
What is the InChIKey of (3S)-3-(4-bromophenyl)-N,N-dimethyl-3-pyridin-2-ylpropan-1-amine?
The InChIKey is FECXXVGLDSSIGK-HJIBXMCBSA-N. The full InChI is InChI=1S/2C16H19BrN2/c2*1-19(2)12-10-15(16-5-3-4-11-18-16)13-6-8-14(17)9-7-13/h2*3-9,11,15H,10,12H2,1-2H3/t2*15-/m00/s1.
What are the key properties of (3S)-3-(4-bromophenyl)-N,N-dimethyl-3-pyridin-2-ylpropan-1-amine?
(3S)-3-(4-bromophenyl)-N,N-dimethyl-3-pyridin-2-ylpropan-1-amine has a molecular weight of 638.49 g/mol, XLogP of 7.86, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-(4-bromophenyl)-N,N-dimethyl-3-pyridin-2-ylpropan-1-amine is sourced from PubChem (CID 90001961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).