About (2,2-dioxooxathiolan-4-yl) 2-methylprop-2-enoate
(2,2-dioxooxathiolan-4-yl) 2-methylprop-2-enoate (PubChem CID 90002294) has the molecular formula C7H10O5S
and a molecular weight of 206.22 g/mol. Its IUPAC name is (2,2-dioxooxathiolan-4-yl) 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | (2,2-dioxooxathiolan-4-yl) 2-methylprop-2-enoate |
| PubChem CID | 90002294 |
| Molecular Formula | C7H10O5S |
| Molecular Weight | 206.22 g/mol |
| Exact Mass | 206.02 |
| IUPAC Name | (2,2-dioxooxathiolan-4-yl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1COS(=O)(=O)C1 |
| InChI | InChI=1S/C7H10O5S/c1-5(2)7(8)12-6-3-11-13(9,10)4-6/h6H,1,3-4H2,2H3 |
| InChIKey | HDHBOYNKKWTINN-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.22 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (2,2-dioxooxathiolan-4-yl) 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,2-dioxooxathiolan-4-yl) 2-methylprop-2-enoate?
The IUPAC name of (2,2-dioxooxathiolan-4-yl) 2-methylprop-2-enoate (CID 90002294) is (2,2-dioxooxathiolan-4-yl) 2-methylprop-2-enoate.
What is the SMILES notation for (2,2-dioxooxathiolan-4-yl) 2-methylprop-2-enoate?
The canonical SMILES for (2,2-dioxooxathiolan-4-yl) 2-methylprop-2-enoate is C=C(C)C(=O)OC1COS(=O)(=O)C1.
What is the InChIKey of (2,2-dioxooxathiolan-4-yl) 2-methylprop-2-enoate?
The InChIKey is HDHBOYNKKWTINN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O5S/c1-5(2)7(8)12-6-3-11-13(9,10)4-6/h6H,1,3-4H2,2H3.
What are the key properties of (2,2-dioxooxathiolan-4-yl) 2-methylprop-2-enoate?
(2,2-dioxooxathiolan-4-yl) 2-methylprop-2-enoate has a molecular weight of 206.22 g/mol, XLogP of -0.17, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2,2-dioxooxathiolan-4-yl) 2-methylprop-2-enoate is sourced from PubChem (CID 90002294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).