About 3-(2,6-diiodophenyl)-4,5-dimethyl-2H-1,3-thiazole
3-(2,6-diiodophenyl)-4,5-dimethyl-2H-1,3-thiazole (PubChem CID 90002390) has the molecular formula C11H11I2NS
and a molecular weight of 443.09 g/mol. Its IUPAC name is 3-(2,6-diiodophenyl)-4,5-dimethyl-2H-1,3-thiazole.
Molecular Properties
| Compound Name | 3-(2,6-diiodophenyl)-4,5-dimethyl-2H-1,3-thiazole |
| PubChem CID | 90002390 |
| Molecular Formula | C11H11I2NS |
| Molecular Weight | 443.09 g/mol |
| Exact Mass | 442.87 |
| IUPAC Name | 3-(2,6-diiodophenyl)-4,5-dimethyl-2H-1,3-thiazole |
| SMILES | CC1=C(C)N(c2c(I)cccc2I)CS1 |
| InChI | InChI=1S/C11H11I2NS/c1-7-8(2)15-6-14(7)11-9(12)4-3-5-10(11)13/h3-5H,6H2,1-2H3 |
| InChIKey | KDADFKSLMALTGI-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 443.09 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-(2,6-diiodophenyl)-4,5-dimethyl-2H-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,6-diiodophenyl)-4,5-dimethyl-2H-1,3-thiazole?
The IUPAC name of 3-(2,6-diiodophenyl)-4,5-dimethyl-2H-1,3-thiazole (CID 90002390) is 3-(2,6-diiodophenyl)-4,5-dimethyl-2H-1,3-thiazole.
What is the SMILES notation for 3-(2,6-diiodophenyl)-4,5-dimethyl-2H-1,3-thiazole?
The canonical SMILES for 3-(2,6-diiodophenyl)-4,5-dimethyl-2H-1,3-thiazole is CC1=C(C)N(c2c(I)cccc2I)CS1.
What is the InChIKey of 3-(2,6-diiodophenyl)-4,5-dimethyl-2H-1,3-thiazole?
The InChIKey is KDADFKSLMALTGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11I2NS/c1-7-8(2)15-6-14(7)11-9(12)4-3-5-10(11)13/h3-5H,6H2,1-2H3.
What are the key properties of 3-(2,6-diiodophenyl)-4,5-dimethyl-2H-1,3-thiazole?
3-(2,6-diiodophenyl)-4,5-dimethyl-2H-1,3-thiazole has a molecular weight of 443.09 g/mol, XLogP of 4.66, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,6-diiodophenyl)-4,5-dimethyl-2H-1,3-thiazole is sourced from PubChem (CID 90002390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).